1,3,5-Triazine-2,4-diamine,6-(4-aminophenyl)- structure
|
Common Name | 1,3,5-Triazine-2,4-diamine,6-(4-aminophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 15074-26-7 | Molecular Weight | 202.21600 | |
| Density | 1.431g/cm3 | Boiling Point | 576.4ºC at 760 mmHg | |
| Molecular Formula | C9H10N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 337.4ºC | |
| Name | 6-(4-aminophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.431g/cm3 |
|---|---|
| Boiling Point | 576.4ºC at 760 mmHg |
| Molecular Formula | C9H10N6 |
| Molecular Weight | 202.21600 |
| Flash Point | 337.4ºC |
| Exact Mass | 202.09700 |
| PSA | 116.73000 |
| LogP | 2.02880 |
| Vapour Pressure | 2.75E-13mmHg at 25°C |
| Index of Refraction | 1.755 |
| InChIKey | RNHRKMKJMHJDDD-UHFFFAOYSA-N |
| SMILES | Nc1ccc(-c2nc(N)nc(N)n2)cc1 |
| HS Code | 2933699090 |
|---|
|
~%
1,3,5-Triazine-... CAS#:15074-26-7 |
| Literature: Am. Cyanamid Co. Patent: US2309679 , 1941 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 2-p-Aminophenyl-4,6-diamino-s-triazin |