1,3,5-TRIAZINE-2,4-DIAMINE, 6-(4-METHYLPHENYL)- structure
|
Common Name | 1,3,5-TRIAZINE-2,4-DIAMINE, 6-(4-METHYLPHENYL)- | ||
|---|---|---|---|---|
| CAS Number | 19338-12-6 | Molecular Weight | 201.22800 | |
| Density | 1.296g/cm3 | Boiling Point | 490.6ºC at 760mmHg | |
| Molecular Formula | C10H11N5 | Melting Point | 239.5-243.5ºC(lit.) | |
| MSDS | N/A | Flash Point | 282.5ºC | |
| Name | 6-(4-methylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.296g/cm3 |
|---|---|
| Boiling Point | 490.6ºC at 760mmHg |
| Melting Point | 239.5-243.5ºC(lit.) |
| Molecular Formula | C10H11N5 |
| Molecular Weight | 201.22800 |
| Flash Point | 282.5ºC |
| Exact Mass | 201.10100 |
| PSA | 90.71000 |
| LogP | 2.17380 |
| Vapour Pressure | 9.01E-10mmHg at 25°C |
| Index of Refraction | 1.676 |
| InChIKey | DECZZKFYYMMMCQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2nc(N)nc(N)n2)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37 |
| HS Code | 2933699090 |
|
~80%
1,3,5-TRIAZINE-... CAS#:19338-12-6 |
| Literature: Peng, Yanqing; Song, Gonghua Tetrahedron Letters, 2004 , vol. 45, # 27 p. 5313 - 5316 |
|
~74%
1,3,5-TRIAZINE-... CAS#:19338-12-6 |
| Literature: Cooke; Augier de Cremiers; Rotello; Tarbit; Vanderstraeten Tetrahedron, 2001 , vol. 57, # 14 p. 2787 - 2789 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 6-p-tolyl-1,3,5-triazine-2,4-diamine |
| 2,4-diamino-p-tolyl-1,3,5-triazine |
| 2,4-Diamino-6-(4-methylphenyl)-1,3,5-triazine |
| 4'-methylbenzoguanamine |
| MFCD00269392 |
| p-Tolylphenylguanamin |
| 6-p-Tolyl-[1,3,5]triazin-2,4-diyldiamin |
| 6-p-tolyl-[1,3,5]triazine-2,4-diyldiamine |