1,3,5-TRIAZINE-2,4-DIAMINE, 6-(4-FLUOROPHENYL)- structure
|
Common Name | 1,3,5-TRIAZINE-2,4-DIAMINE, 6-(4-FLUOROPHENYL)- | ||
|---|---|---|---|---|
| CAS Number | 30530-44-0 | Molecular Weight | 205.19200 | |
| Density | 1.433g/cm3 | Boiling Point | 486.1ºC at 760 mmHg | |
| Molecular Formula | C9H8FN5 | Melting Point | 276-280ºC(lit.) | |
| MSDS | N/A | Flash Point | 247.8ºC | |
| Name | 6-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.433g/cm3 |
|---|---|
| Boiling Point | 486.1ºC at 760 mmHg |
| Melting Point | 276-280ºC(lit.) |
| Molecular Formula | C9H8FN5 |
| Molecular Weight | 205.19200 |
| Flash Point | 247.8ºC |
| Exact Mass | 205.07600 |
| PSA | 90.71000 |
| LogP | 2.00450 |
| Index of Refraction | 1.671 |
| InChIKey | UPQUQQDAZPFXCH-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)nc(-c2ccc(F)cc2)n1 |
|
~79%
1,3,5-TRIAZINE-... CAS#:30530-44-0 |
| Literature: Cooke; Augier de Cremiers; Rotello; Tarbit; Vanderstraeten Tetrahedron, 2001 , vol. 57, # 14 p. 2787 - 2789 |
|
~81%
1,3,5-TRIAZINE-... CAS#:30530-44-0 |
| Literature: Peng, Yanqing; Song, Gonghua Tetrahedron Letters, 2004 , vol. 45, # 27 p. 5313 - 5316 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| p-Fluorophenylguanamin |
| 2,4-Diamino-6-(p-fluorphenyl)-s-triazin |
| 6-(4-fluoro-phenyl)-[1,3,5]triazine-2,4-diamine |
| MFCD00737286 |
| 2,4-Diamino-6-(4-fluorophenyl)-1,3,5-triazine |
| [185] 2,4-Diamino-6-(4-fluorophenyl)-1,3,5-triazine |
| 4'-fluorobenzoguanamine |