1,3,5-Triazine-2,4-diamine,6-(4-chlorophenyl)- structure
|
Common Name | 1,3,5-Triazine-2,4-diamine,6-(4-chlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 4514-53-8 | Molecular Weight | 221.64600 | |
| Density | 1.468 g/cm3 | Boiling Point | 513.5ºC at 760 mmHg | |
| Molecular Formula | C9H8ClN5 | Melting Point | 248-252ºC(lit.) | |
| MSDS | USA | Flash Point | 264.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 6-(4-chlorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.468 g/cm3 |
|---|---|
| Boiling Point | 513.5ºC at 760 mmHg |
| Melting Point | 248-252ºC(lit.) |
| Molecular Formula | C9H8ClN5 |
| Molecular Weight | 221.64600 |
| Flash Point | 264.4ºC |
| Exact Mass | 221.04700 |
| PSA | 90.71000 |
| LogP | 2.51880 |
| Index of Refraction | 1.702 |
| InChIKey | ZHMAVICRSKFCFD-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)nc(-c2ccc(Cl)cc2)n1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933699090 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| MFCD00124382 |
| 4'-chlorobenzoguanamine |