Boc-Lys(Boc)-OH·DCHA structure
|
Common Name | Boc-Lys(Boc)-OH·DCHA | ||
|---|---|---|---|---|
| CAS Number | 15098-69-8 | Molecular Weight | 527.737 | |
| Density | N/A | Boiling Point | 672.6ºC at 760 mmHg | |
| Molecular Formula | C28H53N3O6 | Melting Point | 139-143℃ | |
| MSDS | N/A | Flash Point | 360.6ºC | |
| Name | Nα,Nε-Di-Boc-L-lysine Dicyclohexylammonium Salt |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 672.6ºC at 760 mmHg |
|---|---|
| Melting Point | 139-143℃ |
| Molecular Formula | C28H53N3O6 |
| Molecular Weight | 527.737 |
| Flash Point | 360.6ºC |
| Exact Mass | 527.393433 |
| PSA | 125.99000 |
| LogP | 7.07340 |
| Appearance of Characters | Solid | White |
| Vapour Pressure | 7.74E-20mmHg at 25°C |
| InChIKey | HRLHJTYAMCGERD-MERQFXBCSA-N |
| SMILES | C1CCC(NC2CCCCC2)CC1.CC(C)(C)OC(=O)NCCCCC(NC(=O)OC(C)(C)C)C(=O)O |
| Storage condition | −20°C |
| Safety Phrases | 24/25 |
|---|---|
| WGK Germany | 3 |
| Nα,Nε-Bis(tert-butoxycarbonyl)-L-lysine Dicyclohexylammonium Salt |
| N-Cyclohexylcyclohexanaminium (2S)-2,6-bis({[(2-methyl-2-propanyl)oxy]carbonyl}amino)hexanoate |
| Boc-Lys(Boc)-OH·DCHA |
| EINECS 239-150-9 |
| MFCD00038892 |
| N,N-Bis(tert-butoxycarbonyl)-L-lysine - N-cyclohexylcyclohexanamine (1:1) |
| Dicyclohexylamine (S)-2,6-bis((tert-butoxycarbonyl)amino)hexanoate |
| (2S)-2,6-Bis({[(2-methyl-2-propanyl)oxy]carbonyl}amino)hexanoic acid - N-cyclohexylcyclohexanamine (1:1) |
| (2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid,N-cyclohexylcyclohexanamine |
| L-Lysine, N,N-bis[(1,1-dimethylethoxy)carbonyl]-, compd. with N-cyclohexylcyclohexanamine (1:1) |
| N,N-Bis{[(2-methyl-2-propanyl)oxy]carbonyl}-L-lysine - N-cyclohexylcyclohexanamine (1:1) |
| BOC-LYS(BOC)-OHDCHA |