Boc-Lys(Boc)-OH structure
|
Common Name | Boc-Lys(Boc)-OH | ||
|---|---|---|---|---|
| CAS Number | 2483-46-7 | Molecular Weight | 346.419 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 514.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H30N2O6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 264.9±28.7 °C | |
Use of Boc-Lys(Boc)-OH(S)-2,6-Bis((tert-butoxycarbonyl)amino)hexanoic acid is a polypeptide derivative, can be used to synthesis multifunctional amphiphilic peptide dendrimer, as a nonviral gene vectors, realizes the method in cancer research. (S)-2,6-Bis((tert-butoxycarbonyl)amino)hexanoic acid also involves in the synthesis of an organic substance that increases the luminescence intensity of alkaline phosphatase substrates[1][2]. |
| Name | (2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | (S)-2,6-Bis((tert-butoxycarbonyl)amino)hexanoic acid is a polypeptide derivative, can be used to synthesis multifunctional amphiphilic peptide dendrimer, as a nonviral gene vectors, realizes the method in cancer research. (S)-2,6-Bis((tert-butoxycarbonyl)amino)hexanoic acid also involves in the synthesis of an organic substance that increases the luminescence intensity of alkaline phosphatase substrates[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 514.4±45.0 °C at 760 mmHg |
| Molecular Formula | C16H30N2O6 |
| Molecular Weight | 346.419 |
| Flash Point | 264.9±28.7 °C |
| Exact Mass | 346.210388 |
| PSA | 113.96000 |
| LogP | 2.52 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Index of Refraction | 1.478 |
| InChIKey | FBVSXKMMQOZUNU-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCC(NC(=O)OC(C)(C)C)C(=O)O |
| Storage condition | Store at 0°C |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2924199090 |
| Precursor 10 | |
|---|---|
| DownStream 6 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N'-di-Boc-L-lysine |
| Di[N-(tert-butoxycarbonyl)]-L-lysine |
| AmbotzBAA1104 |
| L-Lysine, N,N-bis[(1,1-dimethylethoxy)carbonyl]- |
| N2,N6-Bis[(1,1-dimethylethoxy)carbonyl]-L-lysine |
| di-BOC-L-lysine |
| Boc-L-Lys(Boc)-OH |
| (S)-2,6-Bis((tert-butoxycarbonyl)amino)hexanoic acid |
| MFCD00038515 |
| N2,N6-Bis-Boc-L-lysine |
| (2S)-2,6-Bis({[(Tert-Butoxy)Carbonyl]Amino})Hexanoic Acid |
| BOC-LYS(BOC)-OH |
| N,N-Bis{[(2-methyl-2-propanyl)oxy]carbonyl}-L-lysine |
| (S)-2,6-Bis-tert-butoxycarbonylaminohexanoic acid |
| N,N-Bis(tert-butoxycarbonyl)-L-lysine |
| Nalpha,Nepsilon-Di-Boc-L-lysine |