Levomefolate calcium structure
|
Common Name | Levomefolate calcium | ||
|---|---|---|---|---|
| CAS Number | 151533-22-1 | Molecular Weight | 497.518 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H23CaN7O6 | Melting Point | >300ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of Levomefolate calciumLevomefolate is an artificial form of folate.IC50 Value:Target: AntifolateThe calcium salt of L-5-methyltetrahydrofolic acid which belongs to the group of folate vitamins (Vitamin B9, Folacin). It is a coenzymated form of folic acid and a more bioavailable alternative in dietary supplements. |
| Name | Levomefolate calcium |
|---|---|
| Synonym | More Synonyms |
| Description | Levomefolate is an artificial form of folate.IC50 Value:Target: AntifolateThe calcium salt of L-5-methyltetrahydrofolic acid which belongs to the group of folate vitamins (Vitamin B9, Folacin). It is a coenzymated form of folic acid and a more bioavailable alternative in dietary supplements. |
|---|---|
| Related Catalog | |
| References |
[5]. Levomefolic_acid |
| Melting Point | >300ºC |
|---|---|
| Molecular Formula | C20H23CaN7O6 |
| Molecular Weight | 497.518 |
| Exact Mass | 497.133575 |
| PSA | 208.43000 |
| InChIKey | VWBBRFHSPXRJQD-QNTKWALQSA-L |
| SMILES | CN1c2c([O-])nc(N)nc2NCC1CNc1ccc(C(=O)NC(CCC(=O)[O-])C(=O)O)cc1.[Ca+2] |
| Storage condition | -20?C Freezer |
| Safety Phrases | 24/25 |
|---|---|
| HS Code | 29339900 |
| Bodyfolin |
| CALCIUML-5-METHYLTETRAHYDROFOLATE |
| Levomefolinate calcium |
| Nutrifolin |
| Calcium (2S)-2-{[4-({[(6S)-2-amino-5-methyl-4-oxo-1,4,5,6,7,8-hexahydro-6-pteridinyl]methyl}amino)benzoyl]amino}pentanedioate |
| L-5-MTHF-Ca |
| L-5-Methyltetrahydrofolate calcium |
| Levomefolate Calcium |
| L-5-Methyletrahydrofolate calciuM |
| Calcium levomefolate |
| L-Glutamic acid, N-[4-[[[(6S)-2-amino-1,4,5,6,7,8-hexahydro-5-methyl-4-oxo-6-pteridinyl]methyl]amino]benzoyl]-, calcium salt (1:1) |
| LMCA |
| Calcium (2S)-2-{[4-({[(6S)-2-amino-5-methyl-4-oxo-1,4,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)benzoyl]amino}pentanedioate |
| Folic Acid Impurity 3 |