Pitavastatin calcium structure
|
Common Name | Pitavastatin calcium | ||
|---|---|---|---|---|
| CAS Number | 147526-32-7 | Molecular Weight | 440.49 | |
| Density | N/A | Boiling Point | 692ºC at 760 mmHg | |
| Molecular Formula | C25H23FNO4.1/2Ca | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 372.3ºC | |
Use of Pitavastatin calciumPitavastatin Calcium is a potent hydroxymethylglutaryl-CoA (HMG-CoA) reductase inhibitor. Pitavastatin inhibits cholesterol synthesis from acetic acid with an IC50 of 5.8 nM in HepG2 cells. |
| Name | pitavastatin calcium |
|---|---|
| Synonym | More Synonyms |
| Description | Pitavastatin Calcium is a potent hydroxymethylglutaryl-CoA (HMG-CoA) reductase inhibitor. Pitavastatin inhibits cholesterol synthesis from acetic acid with an IC50 of 5.8 nM in HepG2 cells. |
|---|---|
| Related Catalog | |
| References |
[1]. Mukhtar RY, et al. Pitavastatin. Int J Clin Pract. 2005 Feb;59(2):239-52. |
| Boiling Point | 692ºC at 760 mmHg |
|---|---|
| Molecular Formula | C25H23FNO4.1/2Ca |
| Molecular Weight | 440.49 |
| Flash Point | 372.3ºC |
| PSA | 186.96000 |
| LogP | 6.36680 |
| InChIKey | AMUDYCAFPCQTAZ-NRFPMOEYSA-N |
| SMILES | O=C(O)CC(O)CC(O)C=Cc1c(C2CC2)nc2ccccc2c1-c1ccc(F)cc1.[Ca] |
| Storage condition | -20°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933499090 |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Heptenoic acid, 7-[2-cyclopropyl-4-(4-fluorophenyl)-3-quinolinyl]-3,5-dihydroxy-, calcium salt, (3R,5S,6E)- (2:1) |
| Pitavastatin Calcium |
| Livalo |
| Calcium bis{(3R,5S,6E)-7-[2-cyclopropyl-4-(4-fluorophenyl)-3-quinolinyl]-3,5-dihydroxy-6-heptenoate} |
| MFCD01937979 |
| UNII-IYD54XEG3W |
| Pitavastatin (Calcium) |
| calcium,(E,3R,5S)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-3,5-dihydroxyhept-6-enoate |
| Livazo |
| (+)-Monocalciumbis{(3R,5S,6E)-7-[2-cyclopropyl-4-(4-fluorophenyl)-3-quinolyl]-3,5-dihydroxy-6-heptenoate} |
| (3R,5S,6E)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-3,5-dihydroxy-hept-6-enoic acid |
| NK-104 |
| [3H]-Pitavastatin |
| Alipza |
| Pitavastatin hemicalcium |
| Nisvastatin |
| [14C]-Pitavastatin |
| (+)-Monocalcium bis{(3R,5S,6E)-7-[2-cyclopropyl-4-(4-fluorophenyl)-3-quinolyl]-3,5-dihydroxy-6-heptenoate} |