Ethyl-(4-acetylphenyl)acetat structure
|
Common Name | Ethyl-(4-acetylphenyl)acetat | ||
|---|---|---|---|---|
| CAS Number | 1528-42-3 | Molecular Weight | 206.238 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 315.5±25.0 °C at 760 mmHg | |
| Molecular Formula | C12H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.4±23.2 °C | |
| Name | Ethyl (4-acetylphenyl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 315.5±25.0 °C at 760 mmHg |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.238 |
| Flash Point | 137.4±23.2 °C |
| Exact Mass | 206.094299 |
| PSA | 43.37000 |
| LogP | 1.94 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.510 |
| InChIKey | UYKWAZSTKGYKOG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1ccc(C(C)=O)cc1 |
| HS Code | 2918300090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Ethyl (4-acetylphenyl)acetate |
| Ethyl 4-acetylphenylacetate |
| ethyl p-acetylphenylacetate |
| Ethyl-(4-acetylphenyl)acetat |
| para-acetyl-phenylacetic acid ethyl ester |
| Benzeneacetic acid, 4-acetyl-, ethyl ester |