alpha-Lapachone structure
|
Common Name | alpha-Lapachone | ||
|---|---|---|---|---|
| CAS Number | 4707-33-9 | Molecular Weight | 242.270 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 372.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C15H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.5±27.9 °C | |
Use of alpha-Lapachoneα-Lapachone shows trypanocidal activity[1]. |
| Name | 2,2-dimethyl-3,4-dihydrobenzo[g]chromene-5,10-dione |
|---|---|
| Synonym | More Synonyms |
| Description | α-Lapachone shows trypanocidal activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 372.9±42.0 °C at 760 mmHg |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.270 |
| Flash Point | 165.5±27.9 °C |
| Exact Mass | 242.094299 |
| PSA | 43.37000 |
| LogP | 3.13 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | PJWHOPKRRBUSDH-UHFFFAOYSA-N |
| SMILES | CC1(C)CCC2=C(O1)C(=O)c1ccccc1C2=O |
| Hazard Codes | Xi |
|---|
| Precursor 9 | |
|---|---|
| DownStream 4 | |
| 2,2-Dimethyl-3,4-dihydro-2H-benzo[g]chromene-5,10-dione |
| α-Lapachone |
| 2H-Naphtho[2,3-b]pyran-5,10-dione, 3,4-dihydro-2,2-dimethyl- |