2,3,4,5,6-Pentafluorobenzophenone structure
|
Common Name | 2,3,4,5,6-Pentafluorobenzophenone | ||
|---|---|---|---|---|
| CAS Number | 1536-23-8 | Molecular Weight | 272.17000 | |
| Density | 1.443g/cm3 | Boiling Point | 93 °C0.2 mm Hg(lit.) | |
| Molecular Formula | C13H5F5O | Melting Point | 36-39 °C(lit.) | |
| MSDS | N/A | Flash Point | >230 °F | |
| Name | 2,3,4,5,6-Pentafluorobenzophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.443g/cm3 |
|---|---|
| Boiling Point | 93 °C0.2 mm Hg(lit.) |
| Melting Point | 36-39 °C(lit.) |
| Molecular Formula | C13H5F5O |
| Molecular Weight | 272.17000 |
| Flash Point | >230 °F |
| Exact Mass | 272.02600 |
| PSA | 17.07000 |
| LogP | 3.61310 |
| InChIKey | HCCPWBWOSASKLG-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1c(F)c(F)c(F)c(F)c1F |
| Storage condition | 0-10°C |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
| HS Code | 2914700090 |
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| MFCD00000294 |
| EINECS 216-258-4 |
| (2,3,4,5,6-pentafluorophenyl)-phenylmethanone |