N-[2-Isopropylthiazol-4-ylmethyl(methyl)carbamoyl]-L-valine structure
|
Common Name | N-[2-Isopropylthiazol-4-ylmethyl(methyl)carbamoyl]-L-valine | ||
|---|---|---|---|---|
| CAS Number | 154212-61-0 | Molecular Weight | 313.416 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 532.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C14H23N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.9±27.3 °C | |
Use of N-[2-Isopropylthiazol-4-ylmethyl(methyl)carbamoyl]-L-valineUreidovaline is an intermediate in the synthesis of Ritonavir. |
| Name | (2S)-3-methyl-2-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 532.6±40.0 °C at 760 mmHg |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.416 |
| Flash Point | 275.9±27.3 °C |
| Exact Mass | 313.146027 |
| PSA | 110.77000 |
| LogP | 1.88 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.545 |
| InChIKey | OSQWRZICKAOBFA-NSHDSACASA-N |
| SMILES | CC(C)c1nc(CN(C)C(=O)NC(C(=O)O)C(C)C)cs1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2934100090 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| L-Valine, N-[[methyl[[2-(1-methylethyl)-4-thiazolyl]methyl]amino]carbonyl]- |
| Ureidovaline |
| N-(methyl{[2-(propan-2-yl)-1,3-thiazol-4-yl]methyl}carbamoyl)-L-valine |
| N-{[(2-Isopropyl-1,3-thiazol-4-yl)methyl](methyl)carbamoyl}-L-valine |
| N-[2-Isopropylthiazol-4-ylMethyl(Methyl)carbaMoyl]-L-valine |
| N-((N-METHYL-N-((2-ISOPROPYL-4-THIAZOLYL)METHYL)AMINO)CARBONYL)-L-VALINE |