3,5-Bis(tert-butyl)benzaldehyde structure
|
Common Name | 3,5-Bis(tert-butyl)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 17610-00-3 | Molecular Weight | 218.335 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 266.2±9.0 °C at 760 mmHg | |
| Molecular Formula | C15H22O | Melting Point | 85-89 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 53.1±5.0 °C | |
| Name | 3,5-Bis(tert-butyl)benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 266.2±9.0 °C at 760 mmHg |
| Melting Point | 85-89 °C(lit.) |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.335 |
| Flash Point | 53.1±5.0 °C |
| Exact Mass | 218.167068 |
| PSA | 17.07000 |
| LogP | 5.02 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.507 |
| InChIKey | BRUITYMDHWNCIG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(C=O)cc(C(C)(C)C)c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xn |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914399090 |
| Precursor 9 | |
|---|---|
| DownStream 6 | |
| HS Code | 2914399090 |
|---|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|
Size-selective yolk-shell nanoreactors with nanometer-thin porous polymer shells.
Chemistry 21 , 12709-14, (2015) Yolk-shell nanoreactors with metal nanoparticle core and ultrathin porous polymer shells are effective catalysts for heterogeneous reactions. Polymer shells provide size-selectivity and improved reusa... |
| MFCD00026298 |
| 3,5-Bis(tert-Butyl)benzaldehyde |
| 3,5-Di-tert-butylbenzaldehyde |
| 3,5-ditert-butylbenzaldehyde |
| 3,5-Bis(2-methyl-2-propanyl)benzaldehyde |
| 3,5-di-tert-butylbenzatdehyle |