N-(tert-Butoxycarbonyl)-b-phenyl-L-phenylalaninol structure
|
Common Name | N-(tert-Butoxycarbonyl)-b-phenyl-L-phenylalaninol | ||
|---|---|---|---|---|
| CAS Number | 155836-47-8 | Molecular Weight | 327.417 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 501.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H25NO3 | Melting Point | 114-116 °C(lit.) | |
| MSDS | USA | Flash Point | 256.9±30.1 °C | |
| Name | (S)-tert-Butyl (3-hydroxy-1,1-diphenylpropan-2-yl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 501.2±50.0 °C at 760 mmHg |
| Melting Point | 114-116 °C(lit.) |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.417 |
| Flash Point | 256.9±30.1 °C |
| Exact Mass | 327.183441 |
| PSA | 58.56000 |
| LogP | 4.40 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | OGVCRJDQGBIHAG-QGZVFWFLSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CO)C(c1ccccc1)c1ccccc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 25 |
| Safety Phrases | 45 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
|
~%
N-(tert-Butoxyc... CAS#:155836-47-8 |
| Literature: US5633281 A1, ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Methyl-2-propanyl [(2S)-3-hydroxy-1,1-diphenyl-2-propanyl]carbamate |
| N-Boc-β-phenyl-L-phenylalaninol |
| tert-Butyl [(2S)-3-hydroxy-1,1-diphenylpropan-2-yl]carbamate |
| Carbamic acid, N-[(1S)-1-(hydroxymethyl)-2,2-diphenylethyl]-, 1,1-dimethylethyl ester |
| N-(tert-Butoxycarbonyl)-b-phenyl-L-phenylalaninol |
| tert-Butyl-[(2S)-3-hydroxy-1,1-diphenylpropan-2-yl]carbamat |
| MFCD01863566 |
| tert-butyl [(1S)-1-(hydroxymethyl)-2,2-diphenylethyl]carbamate |