8-Quinolinol,5,7-dibromo-2-methyl- structure
|
Common Name | 8-Quinolinol,5,7-dibromo-2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 15599-52-7 | Molecular Weight | 316.97700 | |
| Density | 1.934 g/cm3 | Boiling Point | 367.4ºC at 760 mmHg | |
| Molecular Formula | C10H7Br2NO | Melting Point | 126-130ºC(lit.) | |
| MSDS | N/A | Flash Point | 176ºC | |
| Name | 5,7-dibromo-2-methylquinolin-8-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.934 g/cm3 |
|---|---|
| Boiling Point | 367.4ºC at 760 mmHg |
| Melting Point | 126-130ºC(lit.) |
| Molecular Formula | C10H7Br2NO |
| Molecular Weight | 316.97700 |
| Flash Point | 176ºC |
| Exact Mass | 314.88900 |
| PSA | 33.12000 |
| LogP | 3.77380 |
| Vapour Pressure | 6.49E-06mmHg at 25°C |
| Index of Refraction | 1.713 |
| InChIKey | BNACJQWJZKPAPV-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(Br)cc(Br)c(O)c2n1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-37/39 |
| HS Code | 2933499090 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,7-Dibrom-2-methyl-chinolin-8-ol |
| 5,7-dibromo-2-methyl-quinolin-8-ol |
| 5,7-Dibromo-2-methyl-8-quinolinol |
| 5,7-Dibromo-8-hydroxyquinaldine |
| 5,7-dibromo-8-hydroxy-2-methylquinoline |
| 5,7-dibromo-2-methyl-8-hydroxyquinoline |
| Broquinaldol |