4,5,6,7-Tetrachloroisoindoline-1,3-dione structure
|
Common Name | 4,5,6,7-Tetrachloroisoindoline-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 1571-13-7 | Molecular Weight | 284.911 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8HCl4NO2 | Melting Point | >300 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3,4,5,6-Tetrachlorophthalimide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Melting Point | >300 °C(lit.) |
| Molecular Formula | C8HCl4NO2 |
| Molecular Weight | 284.911 |
| Exact Mass | 282.876129 |
| PSA | 46.17000 |
| LogP | 3.11 |
| Index of Refraction | 1.655 |
| InChIKey | LPUUYZVKCMCHLO-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c21 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2925190090 |
| Precursor 10 | |
|---|---|
| DownStream 7 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Effect of metal binding and posttranslational lysine carboxylation on the activity of recombinant hydantoinase.
J. Biol. Inorg. Chem. 14(1) , 111-21, (2009) Bacterial hydantoinase possesses a binuclear metal center in which two metal ions are bridged by a posttranslationally carboxylated lysine. How the carboxylated lysine and metal binding affect the act... |
| 4,5,6,7-Tetrachloroisoindoline-1,3-dione |
| 4,5,6,7-tetrachloroisoindole-1,3-dione |
| 3,4,5,6-Tetrachlorophthalimide |
| 4,5,6,7-Tetrachloro-1H-isoindole-1,3(2H)-dione |
| EINECS 216-386-0 |
| 1H-Isoindole-1,3(2H)-dione, 4,5,6,7-tetrachloro- |
| Tetrachlorophthalimide |
| MFCD00005883 |