Stannane,dibutyldiisothiocyanato- structure
|
Common Name | Stannane,dibutyldiisothiocyanato- | ||
|---|---|---|---|---|
| CAS Number | 15719-34-3 | Molecular Weight | 349.09400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18N2S2Sn | Melting Point | 141-143ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dibutyl(diisothiocyanato)stannane |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 141-143ºC |
|---|---|
| Molecular Formula | C10H18N2S2Sn |
| Molecular Weight | 349.09400 |
| Exact Mass | 349.99300 |
| PSA | 88.90000 |
| LogP | 4.23440 |
| InChIKey | JVLGWEJONYVDMO-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(N=C=S)N=C=S |
| Hazard Codes | Xn: Harmful;N: Dangerous for the environment; |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | S14 |
| RIDADR | UN 3146 6.1/PG 3 |
| HS Code | 2930909090 |
|
~%
Stannane,dibuty... CAS#:15719-34-3 |
| Literature: Crowe, Alan J.; Smith, Peter J. Journal of Organometallic Chemistry, 1982 , vol. 224, # 3 p. 223 - 236 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Stannane,dibutyldiisothiocyanato |
| di-n-butyltin diisothiocyanate |
| Di-n-butyl-zinn-bis-isothiocyanat |
| Dibutyltin diisothiocyanate |
| Di-n-butyl-zinn-diisothiocyanat |
| Dibutyldiisothiocyanato-tin |
| Dibutyldiisothiocyanato-stannane |