Stannane,ethenyltriphenyl- structure
|
Common Name | Stannane,ethenyltriphenyl- | ||
|---|---|---|---|---|
| CAS Number | 2117-48-8 | Molecular Weight | 377.05800 | |
| Density | N/A | Boiling Point | 407.6ºC at 760mmHg | |
| Molecular Formula | C20H18Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.8ºC | |
| Name | ethenyl(triphenyl)stannane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 407.6ºC at 760mmHg |
|---|---|
| Molecular Formula | C20H18Sn |
| Molecular Weight | 377.05800 |
| Flash Point | 203.8ºC |
| Exact Mass | 378.04300 |
| LogP | 2.88200 |
| Vapour Pressure | 1.76E-06mmHg at 25°C |
| InChIKey | JCJXEBAQTMCZGK-UHFFFAOYSA-N |
| SMILES | C=C[Sn](c1ccccc1)(c1ccccc1)c1ccccc1 |
| HS Code | 2931900090 |
|---|
|
~84%
Stannane,etheny... CAS#:2117-48-8 |
| Literature: Gmelin Handbook: Sn: Org.Verb.2, 1.1.2.15.4, page 386 - 396 |
|
~83%
Stannane,etheny... CAS#:2117-48-8 |
| Literature: Gmelin Handbook: Sn: Org.Verb.2, 1.1.2.15.4, page 386 - 396 |
|
~66%
Stannane,etheny... CAS#:2117-48-8 |
| Literature: Theobald, Francois; Trimaille, Bernard Journal of Organometallic Chemistry, 1984 , vol. 267, # 2 p. 143 - 150 |
| Precursor 4 | |
|---|---|
| DownStream 9 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Triphenylvinylstannan |
| Stannane,ethenyltriphenyl |
| triphenylvinylstannane |
| Triphenyl vinyl tin |