DDR2-IN-1 structure
|
Common Name | DDR2-IN-1 | ||
|---|---|---|---|---|
| CAS Number | 1573053-23-2 | Molecular Weight | 526.03 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H32ClN5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DDR2-IN-1DDR2-IN-1 is potent DDR2 inhibitor with an IC50 of 26 nM. DDR2-IN-1, compound 129, can be used for osteoarthritis research[1]. |
| Name | 4-(4-((3-(4-chloro-2-(2-(dimethylamino)ethoxy)-5-methylphenyl)ureido)methyl)-2-methylphenoxy)-N-methylpicolinamide |
|---|
| Description | DDR2-IN-1 is potent DDR2 inhibitor with an IC50 of 26 nM. DDR2-IN-1, compound 129, can be used for osteoarthritis research[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 26 nM (DDR2)[1] |
| References |
| Molecular Formula | C27H32ClN5O4 |
|---|---|
| Molecular Weight | 526.03 |
| InChIKey | YKRARSYSXDHLJH-UHFFFAOYSA-N |
| SMILES | CNC(=O)c1cc(Oc2ccc(CNC(=O)Nc3cc(C)c(Cl)cc3OCCN(C)C)cc2C)ccn1 |