tert-butyl 4-amino-3-fluorobenzoate structure
|
Common Name | tert-butyl 4-amino-3-fluorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 157665-53-7 | Molecular Weight | 211.23300 | |
| Density | 1.152g/cm3 | Boiling Point | 321.076ºC at 760 mmHg | |
| Molecular Formula | C11H14FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.982ºC | |
| Name | tert-butyl 4-amino-3-fluorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.152g/cm3 |
|---|---|
| Boiling Point | 321.076ºC at 760 mmHg |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.23300 |
| Flash Point | 147.982ºC |
| Exact Mass | 211.10100 |
| PSA | 52.32000 |
| LogP | 2.94440 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | FYHPHTHRJPRDSU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)c1ccc(N)c(F)c1 |
| Hazard Codes | Xn |
|---|
|
~98%
tert-butyl 4-am... CAS#:157665-53-7 |
| Literature: Springer; Niculescu-Duvaz; Pedley Journal of Medicinal Chemistry, 1994 , vol. 37, # 15 p. 2361 - 2370 |
|
~%
tert-butyl 4-am... CAS#:157665-53-7 |
| Literature: Springer; Niculescu-Duvaz; Pedley Journal of Medicinal Chemistry, 1994 , vol. 37, # 15 p. 2361 - 2370 |
|
~%
tert-butyl 4-am... CAS#:157665-53-7 |
| Literature: Springer; Niculescu-Duvaz; Pedley Journal of Medicinal Chemistry, 1994 , vol. 37, # 15 p. 2361 - 2370 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| tert-Butyl4-amino-3-fluorobenzoate |
| 4-Amino-3-Fluoro-Benzoic Acid 1,1-Dimethylethyl Ester |
| tert-butyl 3-fluoro-4-aminobenzoate |
| t-butyl (4-amino-3-fluoro) benzoate |