Mal-amino-sulfo structure
|
Common Name | Mal-amino-sulfo | ||
|---|---|---|---|---|
| CAS Number | 158018-81-6 | Molecular Weight | 360.29700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O9S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Mal-amino-sulfoMal-amino-sulfo is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | sulfo-n-succinimidyl 4-maleimido |
|---|---|
| Synonym | More Synonyms |
| Description | Mal-amino-sulfo is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1] |
| References |
| Molecular Formula | C12H12N2O9S |
|---|---|
| Molecular Weight | 360.29700 |
| Exact Mass | 360.02600 |
| PSA | 163.81000 |
| InChIKey | LCZVQHWMSQLWSC-UHFFFAOYSA-N |
| SMILES | O=C(CCCN1C(=O)C=CC1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O |
| N-[(1S)-1-carboxy-2-cyanoethyl]-L-glutamine |