2-Naphthalenebutanoicacid, g-oxo- structure
|
Common Name | 2-Naphthalenebutanoicacid, g-oxo- | ||
|---|---|---|---|---|
| CAS Number | 1590-22-3 | Molecular Weight | 228.24300 | |
| Density | N/A | Boiling Point | 459.6ºC at 760 mmHg | |
| Molecular Formula | C14H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-naphthalen-2-yl-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 459.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.24300 |
| Exact Mass | 228.07900 |
| PSA | 54.37000 |
| LogP | 2.88730 |
| Vapour Pressure | 3.04E-09mmHg at 25°C |
| InChIKey | GZKLCZIMSAHQDR-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)c1ccc2ccccc2c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918300090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| MFCD00090143 |