ethyl 2-(3-ethoxy-3-oxopropyl)benzoate structure
|
Common Name | ethyl 2-(3-ethoxy-3-oxopropyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 16023-16-8 | Molecular Weight | 250.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-(3-ethoxy-3-oxopropyl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H18O4 |
|---|---|
| Molecular Weight | 250.29000 |
| Exact Mass | 250.12100 |
| PSA | 52.60000 |
| LogP | 2.35900 |
| InChIKey | RBQKGMZVELTTFC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCc1ccccc1C(=O)OCC |
|
~84%
ethyl 2-(3-etho... CAS#:16023-16-8 |
| Literature: Jensen, Anne Eeg; Dohle, Wolfgang; Knochel, Paul Tetrahedron, 2000 , vol. 56, # 25 p. 4197 - 4201 |
|
~%
ethyl 2-(3-etho... CAS#:16023-16-8 |
| Literature: Titley Journal of the Chemical Society, 1928 , p. 2576 |
| Benzenepropanoic acid,2-(ethoxycarbonyl)-,ethyl ester |
| ethyl 2-(2-ethoxycarbonyl-ethyl)-benzoate |
| 3-(2-ethoxycarbonyl-phenyl)-propionic acid ethyl ester |
| 3-(2-Aethoxycarbonyl-phenyl)-propionsaeure-aethylester |