Cromoglicic acid structure
|
Common Name | Cromoglicic acid | ||
|---|---|---|---|---|
| CAS Number | 16110-51-3 | Molecular Weight | 468.37 | |
| Density | 1.623 | Boiling Point | 752.3ºC at 760 mmHg | |
| Molecular Formula | C23H16O11 | Melting Point | 241-242ºC | |
| MSDS | N/A | Flash Point | 263.9ºC | |
Use of Cromoglicic acidCromolyn is a mast cell stabilizer. Cromolyn has the potential for the research of bronchial asthma, allergic rhinitis, and certain allergic eye conditions such as vernal conjunctivitis, keratitis, and keratoconjunctivitis[1]. |
| Name | cromoglycic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Cromolyn is a mast cell stabilizer. Cromolyn has the potential for the research of bronchial asthma, allergic rhinitis, and certain allergic eye conditions such as vernal conjunctivitis, keratitis, and keratoconjunctivitis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.623 |
|---|---|
| Boiling Point | 752.3ºC at 760 mmHg |
| Melting Point | 241-242ºC |
| Molecular Formula | C23H16O11 |
| Molecular Weight | 468.37 |
| Flash Point | 263.9ºC |
| Exact Mass | 468.06900 |
| PSA | 173.71000 |
| LogP | 2.11450 |
| Vapour Pressure | 1.08E-23mmHg at 25°C |
| Index of Refraction | 1.681 |
| InChIKey | IMZMKUWMOSJXDT-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(=O)c2c(OCC(O)COc3cccc4oc(C(=O)O)cc(=O)c34)cccc2o1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| WGK Germany | 2 |
| RTECS | DJ2380000 |
| HS Code | 2922499990 |
|
~64%
Cromoglicic acid CAS#:16110-51-3 |
| Literature: REVERSE PROTEOMICS RESEARCH INSTITUTE CO., LTD. Patent: US2010/94026 A1, 2010 ; Location in patent: Page/Page column 7-8 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Acidum cromoglicicum |
| cromolyn |
| EINECS 240-279-8 |
| Nalcrom |
| Acide cromoglicique |
| 1,3-bis(2-carboxychromon-5-yloxy)-2-hydroxy propane |
| 1,3-bis(2-carboxy-chromon-5-yloxy)-propan-2-ol |
| 5-[3-(2-carboxy-4-oxochromen-5-yl)oxy-2-hydroxypropoxy]-4-oxochromene-2-carboxylic acid |
| MFCD00057744 |
| Cromoglicic acid |
| Cromoglycate |
| Acido cromoglicico |
| 5,5'-(2-hydroxypropane-1,3-diyl)bis(oxy)bis(4-oxo-4H-chromene-2-carboxylic acid) |
| Lomudal |
| Lomusol |