Lupeol acetate structure
|
Common Name | Lupeol acetate | ||
|---|---|---|---|---|
| CAS Number | 1617-68-1 | Molecular Weight | 468.75400 | |
| Density | 1.01g/cm3 | Boiling Point | 502.7ºC at 760mmHg | |
| Molecular Formula | C32H52O2 | Melting Point | 218ºC | |
| MSDS | N/A | Flash Point | 254.7ºC | |
Use of Lupeol acetateLupeol acetate, a derivative of Lupeol, suppresses the progression of rheumatoid arthritis (RA) by inhibiting the activation of macrophages and osteoclastogenesis through downregulations of TNF-α, IL-1β, MCP-1, COX-2, VEGF and granzyme B[1]. |
| Name | [(1R,3aR,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl] acetate |
|---|---|
| Synonym | More Synonyms |
| Description | Lupeol acetate, a derivative of Lupeol, suppresses the progression of rheumatoid arthritis (RA) by inhibiting the activation of macrophages and osteoclastogenesis through downregulations of TNF-α, IL-1β, MCP-1, COX-2, VEGF and granzyme B[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.01g/cm3 |
|---|---|
| Boiling Point | 502.7ºC at 760mmHg |
| Melting Point | 218ºC |
| Molecular Formula | C32H52O2 |
| Molecular Weight | 468.75400 |
| Flash Point | 254.7ºC |
| Exact Mass | 468.39700 |
| PSA | 26.30000 |
| LogP | 8.59560 |
| Vapour Pressure | 3.1E-10mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | ODSSDTBFHAYYMD-UHFFFAOYSA-N |
| SMILES | C=C(C)C1CCC2(C)CCC3(C)C(CCC4C5(C)CCC(OC(C)=O)C(C)(C)C5CCC43C)C12 |
| Hazard Codes | Xi |
|---|
| 3-O-acetyl-lupeol |
| lup-20(29)-en-3-yl acetate |
| (3beta)-lup-20(29)-en-3-yl acetate |
| lupeol acetate |
| 3-acetoxy-28-deoxobetulin |
| 3-Acetyllupeol |
| Lupeyl acetate |
| LUPENYL ACETATE |