Lupenone structure
|
Common Name | Lupenone | ||
|---|---|---|---|---|
| CAS Number | 1617-70-5 | Molecular Weight | 424.702 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 487.9±12.0 °C at 760 mmHg | |
| Molecular Formula | C30H48O | Melting Point | 165-167ºC | |
| MSDS | N/A | Flash Point | 278.4±5.7 °C | |
Use of LupenoneLupenone, isolated from Rhizoma Musae, belongs to lupane type triterpenoids. Lupenone shows various pharmacological activities including anti-inflammatory, anti-virus, anti-diabetes, anti-cancer, improving Chagas disease without major toxicity[1][2]. |
| Name | lupenone |
|---|---|
| Synonym | More Synonyms |
| Description | Lupenone, isolated from Rhizoma Musae, belongs to lupane type triterpenoids. Lupenone shows various pharmacological activities including anti-inflammatory, anti-virus, anti-diabetes, anti-cancer, improving Chagas disease without major toxicity[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 487.9±12.0 °C at 760 mmHg |
| Melting Point | 165-167ºC |
| Molecular Formula | C30H48O |
| Molecular Weight | 424.702 |
| Flash Point | 278.4±5.7 °C |
| Exact Mass | 424.370514 |
| PSA | 17.07000 |
| LogP | 10.39 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.510 |
| InChIKey | GRBHNQFQFHLCHO-BHMAJAPKSA-N |
| SMILES | C=C(C)C1CCC2(C)CCC3(C)C(CCC4C5(C)CCC(=O)C(C)(C)C5CCC43C)C12 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 29142990 |
| Lupenone |
| (1R,3aR,4S,5aR,5bR,7aR,11aR,11bR,13aR,13bR)-1-Isopropenyl-3a,5a,5b,8,8,11a-hexamethyl-eicosahydro-cyclopenta[a]chrysen-9-one |
| (1R,3aR,5aR,5bR,7aR,11aR,11bR,13aR,13bR)-3a,5a,5b,8,8,11a-Hexaméthyl-1-(1-propèn-2-yl)icosahydro-9H-cyclopenta[a]chrysén-9-one |
| (1R,3aR,5aR,5bR,7aR,11aR,11bR,13aR,13bR)-1-Isopropenyl-3a,5a,5b,8,8,11a-hexamethylicosahydro-9H-cyclopenta[a]chrysen-9-one |
| Lup-2-en-1-one |
| (1R,3aR,5aR,5bR,7aR,11aR,11bR,13aR,13bR)-1-Isopropenyl-3a,5a,5b,8,8,11a-hexamethylicosahydro-9H-cyclopenta[a]chrysen-9-on |
| Lup-20(29)-en-3-one |
| Lup-20(30)-en-3-one |
| 18-lupen-3-one |