(R)-Butyryl Carnitine Chloride structure
|
Common Name | (R)-Butyryl Carnitine Chloride | ||
|---|---|---|---|---|
| CAS Number | 162067-50-7 | Molecular Weight | 267.75000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H22ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (R)-Butyryl Carnitine ChlorideButyryl-L-carnitine chloride is an acylcarnitine that can be isolated from Plasma/Serum[1]. |
| Name | [(2R)-2-butanoyloxy-3-carboxypropyl]-trimethylazanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Description | Butyryl-L-carnitine chloride is an acylcarnitine that can be isolated from Plasma/Serum[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C11H22ClNO4 |
|---|---|
| Molecular Weight | 267.75000 |
| Exact Mass | 267.12400 |
| PSA | 66.43000 |
| LogP | 0.34650 |
| InChIKey | SRYJSBLNSDMCEA-SBSPUUFOSA-N |
| SMILES | CCCC(=O)OC(CC(=O)O)C[N+](C)(C)C.[Cl-] |
|
~%
(R)-Butyryl Car... CAS#:162067-50-7 |
| Literature: Journal of Chemical Research, , # 6 p. 327 - 330 |
|
~%
(R)-Butyryl Car... CAS#:162067-50-7 |
| Literature: Hoppe-Seyler's Zeitschrift fuer physiologische Chemie, , vol. 343, # 4 p. 231 - 239 |
| (R)-2-(butyryloxy)-3-carboxy-N,N,N-trimethylpropan-1-ammonium chloride |
| (R)-Butyryl Carnitine Chloride |
| n-Butyryl-L(-)-carnitine Chloride |
| Butyrylcarnitine Chloride |
| Butyryl-L-carnitine Chloride |
| (2R)-3-Carboxy-N,N,N-trimethyl-2-(1-oxobutoxy)-1-propanaminium Chloride |
| L-Carnitine Butyryl Ester Chloride |
| (-)-O-Butyryl-carnitin |
| O-butyryl-L-carnitine hydrochloride |