Azido-PEG8-Boc
Modify Date: 2025-09-03 06:49:54
Azido-PEG8-Boc structure
|
Common Name | Azido-PEG8-Boc | ||
|---|---|---|---|---|
| CAS Number | 1623791-99-0 | Molecular Weight | 523.62 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H45N3O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG8-BocAzido-PEG8-Boc is a PEG- and Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs[1]. |
| Name | Azido-PEG8-t-butyl ester |
|---|
| Description | Azido-PEG8-Boc is a PEG- and Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C23H45N3O10 |
|---|---|
| Molecular Weight | 523.62 |
| InChIKey | LBNCLZBCQUTBAP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-] |