Azido-PEG8-CH2CO2H structure
|
Common Name | Azido-PEG8-CH2CO2H | ||
|---|---|---|---|---|
| CAS Number | 1343472-07-0 | Molecular Weight | 453.485 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H35N3O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG8-CH2CO2HN3-PEG8-CH2COOH is a PEG-based PROTAC linker can be used in the synthesis of PROTACs[1]. |
| Name | N3-PEG8-CH2COOH |
|---|---|
| Synonym | More Synonyms |
| Description | N3-PEG8-CH2COOH is a PEG-based PROTAC linker can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C18H35N3O10 |
|---|---|
| Molecular Weight | 453.485 |
| Exact Mass | 453.232239 |
| LogP | -2.88 |
| InChIKey | DVJMSIRMVCBUTE-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCOCCOCCOCCOCC(=O)O |
| Storage condition | 2-8°C |
| AZIDE-PEG8-CH2COOH |