Azido-PEG8-amine structure
|
Common Name | Azido-PEG8-amine | ||
|---|---|---|---|---|
| CAS Number | 857891-82-8 | Molecular Weight | 438.51600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H38N4O8 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Azido-PEG8-amineAzido-PEG8-amine is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2-[2-[2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine |
|---|---|
| Synonym | More Synonyms |
| Description | Azido-PEG8-amine is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C18H38N4O8 |
|---|---|
| Molecular Weight | 438.51600 |
| Exact Mass | 438.26900 |
| PSA | 149.61000 |
| LogP | 0.54126 |
| InChIKey | ZSFGTBJYBWJOLZ-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCOCCOCCOCCOCCN |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Spatioselective Modification of Bicompartmental Polymer Particles and Fibers via Huisgen 1, 3‐Dipolar Cycloaddition Bhaskar S, et al.
Macromol. Rapid Commun. 29(20) , 1655-1660, (2008)
|
| Azido-PEG-amine (n=8) |
| O-(2-Aminoethyl)-O'-(2-azidoethyl)heptaethylene glycol |
| O-(2-Aminoethyl)-O inverted exclamation marka-(2-azidoethyl)heptaethylene glycol |
| 26-Azido-3,6,9,12,15,18,21,24-octaoxahexacosan-1-amine |