PSB CB5 structure
|
Common Name | PSB CB5 | ||
|---|---|---|---|---|
| CAS Number | 1627710-30-8 | Molecular Weight | 384.879 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 549.9±60.0 °C at 760 mmHg | |
| Molecular Formula | C20H17ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286.4±32.9 °C | |
Use of PSB CB5PSB-CB5 is a potent and selective antagonist of GRP18. PSB-CB5 has the potential for the research of metabolic disease and obesity[1]. |
| Name | CID-85469571 |
|---|---|
| Synonym | More Synonyms |
| Description | PSB-CB5 is a potent and selective antagonist of GRP18. PSB-CB5 has the potential for the research of metabolic disease and obesity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 549.9±60.0 °C at 760 mmHg |
| Molecular Formula | C20H17ClN2O2S |
| Molecular Weight | 384.879 |
| Flash Point | 286.4±32.9 °C |
| Exact Mass | 384.069916 |
| LogP | 4.43 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.672 |
| InChIKey | XJBQRMOGMULGPP-PDGQHHTCSA-N |
| SMILES | O=C1C(=Cc2cccc(OCc3ccc(Cl)cc3)c2)N=C2SCCCN12 |
| (2Z)-2-{3-[(4-Chlorobenzyl)oxy]benzylidene}-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-3(2H)-one |
| 5H-Imidazo[2,1-b][1,3]thiazin-3(2H)-one, 2-[[3-[(4-chlorophenyl)methoxy]phenyl]methylene]-6,7-dihydro-, (2Z)- |
| CID-85469571 |