(3β)-Lup-20(29)-ene-3,23-diol structure
|
Common Name | (3β)-Lup-20(29)-ene-3,23-diol | ||
|---|---|---|---|---|
| CAS Number | 163060-07-9 | Molecular Weight | 442.72 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 522.3±23.0 °C at 760 mmHg | |
| Molecular Formula | C30H50O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.9±17.2 °C | |
Use of (3β)-Lup-20(29)-ene-3,23-diol(3β,4α)-Lup-20(29)-ene-3,23-diol (compound 11) is a natural lupane-type triterpenes betulinic acid with anti-tumor activity[1]. |
| Name | (1R,3aR,5aR,5bR,7aR,8R,9S,11aR,11bR,13aR,13bR)-8-(hydroxymethyl)-3a,5a,5b,8,11a-pentamethyl-1-(prop-1-en-2-yl)icosahydro-1H-cyclopenta[a]chrysen-9-ol |
|---|---|
| Synonym | More Synonyms |
| Description | (3β,4α)-Lup-20(29)-ene-3,23-diol (compound 11) is a natural lupane-type triterpenes betulinic acid with anti-tumor activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 522.3±23.0 °C at 760 mmHg |
| Molecular Formula | C30H50O2 |
| Molecular Weight | 442.72 |
| Flash Point | 210.9±17.2 °C |
| Exact Mass | 442.381073 |
| PSA | 40.46000 |
| LogP | 9.33 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | RFCPTXGFYWKJJB-VKUYLFACSA-N |
| SMILES | C=C(C)C1CCC2(C)CCC3(C)C(CCC4C5(C)CCC(O)C(C)(CO)C5CCC43C)C12 |
| Hazard Codes | Xi |
|---|
| Lup-20(29)-ene-3,23-diol, (3β)- |
| (3β)-Lup-20(29)-ene-3,23-diol |