ONC-201 Dihydrochloride structure
|
Common Name | ONC-201 Dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1638178-82-1 | Molecular Weight | 459.411 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H28Cl2N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ONC-201 DihydrochlorideONC-201, also known as TIC10 and imipridone, is a potent, orally active, and stable small molecule that transcriptionally induces TRAIL in a p53-independent manner and crosses the blood-brain barrier. TIC10 induces a sustained up-regulation of TRAIL in tumors and normal cells that may contribute to the demonstrable antitumor activity of TIC10. TIC10 inactivates kinases Akt and extracellular signal-regulated kinase (ERK), leading to the translocation of Foxo3a into the nucleus, where it binds to the TRAIL promoter to up-regulate gene transcription. TIC10 is an efficacious antitumor therapeutic agent that acts on tumor cells and their microenvironment to enhance the concentrations of the endogenous tumor suppressor TRAIL. |
| Name | ONC-201 DIHYDROCHLORIDE |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H28Cl2N4O |
|---|---|
| Molecular Weight | 459.411 |
| Exact Mass | 458.164032 |
| InChIKey | HKBXPCQCBQFDML-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1CN1C(=O)C2=C(CCN(Cc3ccccc3)C2)N2CCN=C12.Cl.Cl |
| Imidazo[1,2-a]pyrido[3,4-e]pyrimidin-5(1H)-one, 2,4,6,7,8,9-hexahydro-4-[(2-methylphenyl)methyl]-7-(phenylmethyl)-, hydrochloride (1:2) |
| 7-Benzyl-4-(2-methylbenzyl)-2,4,6,7,8,9-hexahydroimidazo[1,2-a]pyrido[3,4-e]pyrimidin-5(1H)-one dihydrochloride |
| ONC-201 DIHYDROCHLORIDE |