MC-Ala-Ala-Asn-PAB
Modify Date: 2025-08-26 03:43:21
MC-Ala-Ala-Asn-PAB structure
|
Common Name | MC-Ala-Ala-Asn-PAB | ||
|---|---|---|---|---|
| CAS Number | 1638970-44-1 | Molecular Weight | 572.61 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H36N6O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MC-Ala-Ala-Asn-PABMC-Ala-Ala-Asn-PAB is a linker extracted from patent CN104147612A, page 14. MC-Ala-Ala-Asn-PAB can be used to synthesis the tumor microenvironment specific activated micromolecular targeted conjugate[1]. |
| Name | MC-Ala-Ala-Asn-PAB |
|---|
| Description | MC-Ala-Ala-Asn-PAB is a linker extracted from patent CN104147612A, page 14. MC-Ala-Ala-Asn-PAB can be used to synthesis the tumor microenvironment specific activated micromolecular targeted conjugate[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C27H36N6O8 |
|---|---|
| Molecular Weight | 572.61 |
| InChIKey | PNXHITJHSRUQHS-ZWOKBUDYSA-N |
| SMILES | CC(NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)NC(C)C(=O)NC(CC(N)=O)C(=O)Nc1ccc(CO)cc1 |