Azido-PEG5-Ala-Ala-Asn-PAB
Modify Date: 2025-08-25 11:11:18
Azido-PEG5-Ala-Ala-Asn-PAB structure
|
Common Name | Azido-PEG5-Ala-Ala-Asn-PAB | ||
|---|---|---|---|---|
| CAS Number | 2055048-54-7 | Molecular Weight | 697.73 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H47N7O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG5-Ala-Ala-Asn-PABAzido-PEG5-Ala-Ala-Asn-PAB is a cleavable 5 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | Azido-PEG5-Ala-Ala-Asn-PAB |
|---|
| Description | Azido-PEG5-Ala-Ala-Asn-PAB is a cleavable 5 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Molecular Formula | C30H47N7O12 |
|---|---|
| Molecular Weight | 697.73 |
| InChIKey | OKDSKCFISZTBMN-UHFFFAOYSA-N |
| SMILES | CC(NC(=O)CCOCCOCCOCCOCCOCCN=[N+]=[N-])C(=O)NC(C)C(=O)NC(CC(N)=O)C(=O)Nc1ccc(CO)cc1 |