Benzeneethanol, a,a-diphenyl-4-(phenylsulfonyl)- structure
|
Common Name | Benzeneethanol, a,a-diphenyl-4-(phenylsulfonyl)- | ||
|---|---|---|---|---|
| CAS Number | 16426-10-1 | Molecular Weight | 414.51600 | |
| Density | 1.245g/cm3 | Boiling Point | 583.2ºC at 760mmHg | |
| Molecular Formula | C26H22O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306.5ºC | |
| Name | 2-[4-(benzenesulfonyl)phenyl]-1,1-diphenylethanol |
|---|
| Density | 1.245g/cm3 |
|---|---|
| Boiling Point | 583.2ºC at 760mmHg |
| Molecular Formula | C26H22O3S |
| Molecular Weight | 414.51600 |
| Flash Point | 306.5ºC |
| Exact Mass | 414.12900 |
| PSA | 62.75000 |
| LogP | 6.07880 |
| Vapour Pressure | 1.91E-14mmHg at 25°C |
| Index of Refraction | 1.644 |
| InChIKey | CCUUZKTVGIQWCU-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)c1ccc(CC(O)(c2ccccc2)c2ccccc2)cc1 |
|
~%
Benzeneethanol,... CAS#:16426-10-1 |
| Literature: Crowther,G.P.; Hauser,C.R. Journal of Organic Chemistry, 1968 , vol. 33, # 6 p. 2228 - 2233 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |