Triphenyl-(4-sulfo-butyl)-phosphonium inner salt structure
|
Common Name | Triphenyl-(4-sulfo-butyl)-phosphonium inner salt | ||
|---|---|---|---|---|
| CAS Number | 164982-05-2 | Molecular Weight | 398.45500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H23O3PS | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-triphenylphosphaniumylbutane-1-sulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H23O3PS |
|---|---|
| Molecular Weight | 398.45500 |
| Exact Mass | 398.11100 |
| PSA | 96.89000 |
| LogP | 3.95120 |
| InChIKey | RKQKXPDRWYNUGZ-UHFFFAOYSA-N |
| SMILES | O=S(=O)([O-])CCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR | NONH for all modes of transport |
|
~87%
Triphenyl-(4-su... CAS#:164982-05-2 |
| Literature: Shaterian, Hamid Reza; Ranjbar, Mohammad; Azizi, Kobra Journal of Molecular Liquids, 2011 , vol. 162, # 2 p. 95 - 99 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Triphenyl-(4-sulfo-butyl)-phosphonium inner salt |
| 1-(4-sulfonylbutyl)triphenyphosphonium |
| 4-(Triphenylphosphonio)butane-1-sulfonate |