2,3,4,5-Tetrafluoro-6-nitrobenzoic acid structure
|
Common Name | 2,3,4,5-Tetrafluoro-6-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 16583-08-7 | Molecular Weight | 239.081 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 342.6±42.0 °C at 760 mmHg | |
| Molecular Formula | C7HF4NO4 | Melting Point | 137-141 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 161.0±27.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,3,4,5-Tetrafluoro-6-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 342.6±42.0 °C at 760 mmHg |
| Melting Point | 137-141 °C(lit.) |
| Molecular Formula | C7HF4NO4 |
| Molecular Weight | 239.081 |
| Flash Point | 161.0±27.9 °C |
| Exact Mass | 238.984177 |
| PSA | 83.12000 |
| LogP | 1.39 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.520 |
| InChIKey | JQGBMYKEWLSLCI-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c(F)c(F)c(F)c(F)c1[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2916399090 |
|
~%
2,3,4,5-Tetrafl... CAS#:16583-08-7 |
| Literature: Tetrahedron, , vol. 23, p. 4719 - 4727 |
|
~%
2,3,4,5-Tetrafl... CAS#:16583-08-7 |
| Literature: Tetrahedron, , vol. 23, p. 4719 - 4727 |
|
~%
2,3,4,5-Tetrafl... CAS#:16583-08-7 |
| Literature: Tetrahedron, , vol. 23, p. 4719 - 4727 |
|
~%
2,3,4,5-Tetrafl... CAS#:16583-08-7 |
| Literature: Tetrahedron, , vol. 23, p. 4719 - 4727 |
|
~%
2,3,4,5-Tetrafl... CAS#:16583-08-7 |
| Literature: Tetrahedron, , vol. 23, p. 4719 - 4727 |
|
~%
2,3,4,5-Tetrafl... CAS#:16583-08-7 |
| Literature: Tetrahedron, , vol. 23, p. 4719 - 4727 |
|
~%
2,3,4,5-Tetrafl... CAS#:16583-08-7 |
| Literature: Tetrahedron, , vol. 23, p. 4719 - 4727 |
|
~%
2,3,4,5-Tetrafl... CAS#:16583-08-7 |
| Literature: Tetrahedron, , vol. 23, p. 4719 - 4727 |
| Precursor 7 | |
|---|---|
| DownStream 4 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD02093916 |
| 2,3,4,5-Tetrafluoro-6-nitrobenzoic acid |