2,3,4,5-Tetrafluoronitrobenzene structure
|
Common Name | 2,3,4,5-Tetrafluoronitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 5580-79-0 | Molecular Weight | 195.071 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 182.0±0.0 °C at 760 mmHg | |
| Molecular Formula | C6HF4NO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 81.1±0.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,3,4,5-Tetrafluoronitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 182.0±0.0 °C at 760 mmHg |
| Molecular Formula | C6HF4NO2 |
| Molecular Weight | 195.071 |
| Flash Point | 81.1±0.0 °C |
| Exact Mass | 194.994339 |
| PSA | 45.82000 |
| LogP | 1.32 |
| Vapour Pressure | 1.1±0.3 mmHg at 25°C |
| Index of Refraction | 1.467 |
| InChIKey | MKMDVNZEIQDZEP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(F)c(F)c(F)c1F |
| Storage condition | Refrigerator |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| WGK Germany | 3 |
| HS Code | 2904909090 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Organomercury compounds: XVII. The mercuration of 1, 2, 3, 4-tetrafluorobenzene, 1, 2, 3, 5-tetrafluorobenzene, 2, 3, 5, 6-tetrafluoroanisole, and 2, 3, 4, 5-tetrafluoronitrobenzene. Albrecht HB and Deacon GB.
J. Organomet. Chem. 57(1) , 77-86, (1973)
|
|
|
Aromatic polyfluoro-compounds-LIII reactions of polyflouroarenes with thioureas. Coe PL, et al.
Tetrahedron 28(1) , 105-9, (1972)
|
|
|
Reductively activated “Polar” nucleophilic aromatic substitution. III: The reactions of polyfluoronitrobenzenes with methanol. Niat M, et al.
Tetrahedron Lett. 35(48) , 9059-62, (1994)
|
| 5-Nitro-1,2,3,4-tetrafluorobenzene |
| 2,3,4,5-Tetrafluoronitrobenzene |
| 2,3,5-trifluoronitrobenzene |
| 1-NITRO-2,3,4,5-TETRAFLUOROBENZENE |
| 2-NO2-C6F4H |
| 3,4,5,6-tetrafluoronitrobenzene |
| 4-fluro-3-nitrobenzoic acid |
| MFCD00014686 |
| 2,3,4,5-Tetrafluoron |
| 2,3,4,5-Tetrafluoro-1-nitrobenzene |
| Benzene, 1,2,3,4-tetrafluoro-5-nitro- |
| 1,2,3,4-Tetrafluoro-5-nitrobenzene |
| EINECS 226-972-8 |