Ethyl 5-bromo-1H-indole-2-carboxylate structure
|
Common Name | Ethyl 5-bromo-1H-indole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 16732-70-0 | Molecular Weight | 268.11 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 394.7±22.0 °C at 760 mmHg | |
| Molecular Formula | C11H10BrNO2 | Melting Point | 165 °C | |
| MSDS | Chinese USA | Flash Point | 192.5±22.3 °C | |
Use of Ethyl 5-bromo-1H-indole-2-carboxylateEthyl 5-bromo-1H-indole-2-carboxylate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | Ethyl 5-bromoindole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | Ethyl 5-bromo-1H-indole-2-carboxylate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog | |
| In Vitro | 产品规格5-Bromoindole-2-carboxylic acid ethyl ester;Ethyl 5-Bromoindole-2-carboxylate; |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 394.7±22.0 °C at 760 mmHg |
| Melting Point | 165 °C |
| Molecular Formula | C11H10BrNO2 |
| Molecular Weight | 268.11 |
| Flash Point | 192.5±22.3 °C |
| Exact Mass | 266.989471 |
| PSA | 42.09000 |
| LogP | 3.96 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | LWRLKENDQISGEU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc2cc(Br)ccc2[nH]1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Bromo-2-Indolecarboxylic Acid Ethyl Ester |
| 1H-Indole-2-carboxylic acid, 5-bromo-, ethyl ester |
| T56 BMJ CVO2 GE |
| MFCD00022701 |
| Ethyl 5-bromo-1H-indole-2-carboxylate |
| 5-BROMOINDOLE-2-CARBOXYLIC ACID ETHYL ESTER |
| Ethyl 5-Bromoindole-2-carboxylate |
| 2-(Ethoxycarbonyl)-5-bromo-indole |