N-t-BOC-Cycloleucinal structure
|
Common Name | N-t-BOC-Cycloleucinal | ||
|---|---|---|---|---|
| CAS Number | 168539-99-9 | Molecular Weight | 213.273 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 317.0±21.0 °C at 760 mmHg | |
| Molecular Formula | C11H19NO3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 145.5±22.1 °C | |
| Symbol |
GHS05, GHS07, GHS09 |
Signal Word | Danger | |
| Name | tert-butyl N-(1-formylcyclopentyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 317.0±21.0 °C at 760 mmHg |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.273 |
| Flash Point | 145.5±22.1 °C |
| Exact Mass | 213.136490 |
| PSA | 55.40000 |
| LogP | 1.86 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.477 |
| InChIKey | PJHYKFQYQMRNJR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(C=O)CCCC1 |
| Storage condition | 2-8℃ |
| Symbol |
GHS05, GHS07, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H315-H318-H335-H400 |
| Precautionary Statements | P261-P273-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant;N: Dangerous for the environment; |
| Risk Phrases | R37/38 |
| Safety Phrases | 26-36/37/39-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| HS Code | 2924299090 |
|
~%
N-t-BOC-Cyclole... CAS#:168539-99-9 |
| Literature: WO2005/41664 A1, ; Page/Page column 104 ; |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-t-BOC-Cycloleucinal |
| Boc-1-amino-1-cyclopentanecarboxaldehyde |
| N-tert-butoxycarbonylamino cyclopentanecarboxaldehyde |
| tert-butyl 1-formylcyclopentylcarbamate |
| N-Boc-cycloleucinal |
| 2-Methyl-2-propanyl (1-formylcyclopentyl)carbamate |
| tert-Butyl (1-formylcyclopentyl)carbamate |
| Carbamic acid, N-(1-formylcyclopentyl)-, 1,1-dimethylethyl ester |
| MFCD04973956 |