tetraethylammonium sulfate structure
|
Common Name | tetraethylammonium sulfate | ||
|---|---|---|---|---|
| CAS Number | 16873-13-5 | Molecular Weight | 227.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H21NO4S | Melting Point | 243-245 °C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | Tetraethylammonium hydrogensulfate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 243-245 °C |
|---|---|
| Molecular Formula | C8H21NO4S |
| Molecular Weight | 227.32 |
| Exact Mass | 227.32 |
| PSA | 85.81000 |
| LogP | 1.96820 |
| InChIKey | CREVBWLEPKAZBH-UHFFFAOYSA-M |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])O |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 29239000 |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| MFCD00036150 |
| EINECS 240-899-9 |
| hydrogen sulfate,tetraethylazanium |
| Tetraethylammonium hydrogen sulfate |