H-His-Phe-OH structure
|
Common Name | H-His-Phe-OH | ||
|---|---|---|---|---|
| CAS Number | 16874-81-0 | Molecular Weight | 302.33 | |
| Density | 1.34 g/cm3 | Boiling Point | 693.4ºC at 760 mmHg | |
| Molecular Formula | C15H18N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 373.1ºC | |
Use of H-His-Phe-OHH-His-Phe-OH is adipeptide. |
| Name | (2S)-2-[[(2S)-2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | H-His-Phe-OH is adipeptide. |
|---|---|
| Related Catalog |
| Density | 1.34 g/cm3 |
|---|---|
| Boiling Point | 693.4ºC at 760 mmHg |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 |
| Flash Point | 373.1ºC |
| Exact Mass | 302.13800 |
| PSA | 121.10000 |
| LogP | 1.18280 |
| Vapour Pressure | 3.5E-20mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | XMAUFHMAAVTODF-STQMWFEESA-N |
| SMILES | NC(Cc1cnc[nH]1)C(=O)NC(Cc1ccccc1)C(=O)O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933290090 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Phenylalanylhistidine |
| N-histidyl-phenylalanine |
| Phe-his |
| L-histidinyl-L-phenylalnine |
| N-L-histidyl-L-phenylalanine |
| N-L-Histidyl-L-phenylalanin |
| Histidylphenylalanine |
| L-histidyl-L-phenylalanine |
| His-phe |
| L-Phenylalanine,N-L-histidyl |