Bis(2-methyl-2-propanyl) N-[(benzyloxy)carbonyl]-L-glutamate structure
|
Common Name | Bis(2-methyl-2-propanyl) N-[(benzyloxy)carbonyl]-L-glutamate | ||
|---|---|---|---|---|
| CAS Number | 16881-41-7 | Molecular Weight | 393.47400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H31NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Bis(2-methyl-2-propanyl) N-[(benzyloxy)carbonyl]-L-glutamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H31NO6 |
|---|---|
| Molecular Weight | 393.47400 |
| Exact Mass | 393.21500 |
| PSA | 94.42000 |
| LogP | 3.94940 |
| InChIKey | WJBPSYOIHKOUDL-INIZCTEOSA-N |
| SMILES | CC(C)(C)OC(=O)CCC(NC(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
|
~97%
Bis(2-methyl-2-... CAS#:16881-41-7 |
| Literature: Konnert, Laure; Lamaty, Frederic; Martinez, Jean; Colacino, Evelina Journal of Organic Chemistry, 2014 , vol. 79, # 9 p. 4008 - 4017 |
|
~88%
Bis(2-methyl-2-... CAS#:16881-41-7 |
| Literature: Hamada, Yasumasa; Shibata, Makoto; Sugiura, Tsuneyuki; Kato, Shinji; Shioiri, Takayuki Journal of Organic Chemistry, 1987 , vol. 52, # 7 p. 1252 - 1255 |
| di-tert-butyl methylidenemalonate |
| di-tert-butyl-2-methylenemalonate |
| di-t-butyl 2-methylenemalonate |
| Z-Glu(O-t-Bu)2 |
| 2-methylene-propanedioic acid ditert-butyl ester |
| di-t-butyl methylenemalonate |
| N-Benzyloxycarbonyl-L-glutaminsaeure-di-tert.-butylester |
| 2-methylidenemalonate |
| Di-tert-butyl methylenemalonate |
| Z-L-Glu-(O-t-Bu)-O-t-Bu |
| Z-Glu(OtBu)-OtBu |
| di-tert-butyl N-Cbz-L-glutamate |
| Propanedioic acid,methylene-,bis(1,1-dimethylethyl) ester |
| di-tert-butyl N-[(benzyloxy)carbonyl]-L-glutamate |