Z-Glu-OH structure
|
Common Name | Z-Glu-OH | ||
|---|---|---|---|---|
| CAS Number | 1155-62-0 | Molecular Weight | 281.261 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 529.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C13H15NO6 | Melting Point | 115-117 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 273.8±30.1 °C | |
Use of Z-Glu-OHN-Carbobenzoxy-L-glutamic acid is a glutamic acid derivative[1]. |
| Name | N-Cbz-L-glutamic acid |
|---|---|
| Synonym | More Synonyms |
| Description | N-Carbobenzoxy-L-glutamic acid is a glutamic acid derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 529.1±50.0 °C at 760 mmHg |
| Melting Point | 115-117 °C(lit.) |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.261 |
| Flash Point | 273.8±30.1 °C |
| Exact Mass | 281.089935 |
| PSA | 112.93000 |
| LogP | 0.96 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | PVFCXMDXBIEMQG-JTQLQIEISA-N |
| SMILES | O=C(O)CCC(NC(=O)OCc1ccccc1)C(=O)O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xn |
| Risk Phrases | R20/21/22 |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| Precursor 6 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Antineoplastic activity against mouse EAC allografted in CF1 mouse assessed as animal...
Source: ChEMBL
Target: Ehrlich
External Id: CHEMBL3279992
|
|
Name: The relative ability of compound to promote the growth of Shigella flexneri SA 240, a...
Source: ChEMBL
Target: Shigella flexneri
External Id: CHEMBL807452
|
|
Name: Antineoplastic activity against mouse EAC allografted in CF1 mouse assessed as ascite...
Source: ChEMBL
Target: Ehrlich
External Id: CHEMBL3279994
|
|
Name: Antineoplastic activity against mouse EAC allografted in CF1 mouse assessed as packed...
Source: ChEMBL
Target: Ehrlich
External Id: CHEMBL3279993
|
|
Name: Antineoplastic activity against mouse EAC allografted in CF1 mouse assessed as tumor ...
Source: ChEMBL
Target: Ehrlich
External Id: CHEMBL3279995
|
|
Name: Inhibition of recombinant human His-tagged maltose binding protein fused ANAT express...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3876663
|
| benzyloxycarbonyl-L-glutamic acid |
| Z-L-GLU-OH |
| N-Carbobenzyloxy-L-glutamic Acid |
| N-Benzyloxycarbonyl-L-glutamic acid |
| Z-L-GLUTAMIC ACID |
| N-CBZ-L-GLU-OH |
| Z-GLUTAMIC ACID |
| N-[Phenylmethoxycarbonyl]-L-glutamic acid |
| Z-GLU |
| CBZ-GLU-OH |
| N-Carbobenzoxy-L-glutamic Acid |
| Cbz-L-glutamic acid |
| N-Cbz-L-glutamicacid |
| MFCD00002801 |
| N-Cbz-L-Glutamic acid |
| CBZ-L-Glu-OH |
| N-[(Benzyloxy)carbonyl]-L-glutamic acid |
| Z-GLU-OH |
| EINECS 214-584-1 |
| N-Benzyloxycarbonyl-L-glutaric acid |
| L-N-Cbz-glutamic acid |
| N-(Carbobenzyloxy)-L-glutamic acid,Z-L-Glutamic acid |
| Cbz-D-Glu-OH |
| DL-N-benzyloxycarbonylglutamic acid |