(3-Fluoro-4-morpholin-4-ylphenyl)carbamic acid benzyl ester structure
|
Common Name | (3-Fluoro-4-morpholin-4-ylphenyl)carbamic acid benzyl ester | ||
|---|---|---|---|---|
| CAS Number | 168828-81-7 | Molecular Weight | 330.353 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 451.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C18H19FN2O3 | Melting Point | 123.0 to 127.0 °C | |
| MSDS | N/A | Flash Point | 227.0±28.7 °C | |
| Name | N-Benzyloxycarbonyl-3-Fluoro-4-Morpholinoaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 451.8±45.0 °C at 760 mmHg |
| Melting Point | 123.0 to 127.0 °C |
| Molecular Formula | C18H19FN2O3 |
| Molecular Weight | 330.353 |
| Flash Point | 227.0±28.7 °C |
| Exact Mass | 330.137970 |
| PSA | 50.80000 |
| LogP | 2.87 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | XKGUZGHMWUIYDR-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(N2CCOCC2)c(F)c1)OCc1ccccc1 |
| Hazard Codes | Xi |
|---|
|
~98%
(3-Fluoro-4-mor... CAS#:168828-81-7 |
| Literature: Yang, Bo; Shi, Luyan; Wu, Jingjing; Fang, Xiang; Yang, Xueyan; Wu, Fanhong Tetrahedron, 2013 , vol. 69, # 15 p. 3331 - 3337 |
|
~91%
(3-Fluoro-4-mor... CAS#:168828-81-7 |
| Literature: LIANHE CHEMICAL TECHNOLOGY CO., LTD. Patent: US2011/275805 A1, 2011 ; Location in patent: Page/Page column 7 ; |
|
~%
(3-Fluoro-4-mor... CAS#:168828-81-7 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 12, # 6 p. 857 - 859 |
|
~%
(3-Fluoro-4-mor... CAS#:168828-81-7 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 12, # 6 p. 857 - 859 |
|
~%
(3-Fluoro-4-mor... CAS#:168828-81-7 |
| Literature: WO2011/137222 A1, ; |
|
~%
(3-Fluoro-4-mor... CAS#:168828-81-7 |
| Literature: WO2011/137222 A1, ; |
| Precursor 6 | |
|---|---|
| DownStream 6 | |
| Carbamic acid, N-[3-fluoro-4-(4-morpholinyl)phenyl]-, phenylmethyl ester |
| benzyl [3-fluoro-4-(morpholin-4-yl)phenyl]carbamate |
| N-benzyloxycarbonyl-3-fluoro-4-morpholinoaniline |
| Benzyl (3-Fluoro-4-morpholinophenyl)carbamate |
| (3-Fluoro-4-morpholinophenyl)carbamic Acid Benzyl Ester |
| Benzyl [3-fluoro-4-(4-morpholinyl)phenyl]carbamate |
| benzyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate |
| Linezolid Impurity 6 |
| (3-Fluoro-4-morpholin-4-ylphenyl)carbamic acid benzyl ester |