Tos-Lys(Boc)-OH structure
|
Common Name | Tos-Lys(Boc)-OH | ||
|---|---|---|---|---|
| CAS Number | 16948-09-7 | Molecular Weight | 400.490 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H28N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2S)-2-[(4-methylphenyl)sulfonylamino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Molecular Formula | C18H28N2O6S |
| Molecular Weight | 400.490 |
| Exact Mass | 400.166809 |
| PSA | 133.67000 |
| LogP | 2.84 |
| Index of Refraction | 1.532 |
| InChIKey | GJXKBGKAUIMAKK-HNNXBMFYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NC(CCCCNC(=O)OC(C)(C)C)C(=O)O)cc1 |
| HS Code | 2935009090 |
|---|
|
~99%
Tos-Lys(Boc)-OH CAS#:16948-09-7 |
| Literature: Villani; Heys Journal of Labelled Compounds and Radiopharmaceuticals, 1997 , vol. 39, # 5 p. 379 - 386 |
|
~62%
Tos-Lys(Boc)-OH CAS#:16948-09-7 |
| Literature: Maeda; Okada; Sogabe; Kawasaki Chemical and pharmaceutical bulletin, 1985 , vol. 33, # 5 p. 2137 - 2141 |
|
~%
Tos-Lys(Boc)-OH CAS#:16948-09-7 |
| Literature: Villani; Heys Journal of Labelled Compounds and Radiopharmaceuticals, 1997 , vol. 39, # 5 p. 379 - 386 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| N-(tert-butoxycarbonyl)-N-[(4-methylphenyl)sulfonyl]-L-lysine |
| N2-[(4-Methylphenyl)Sulfonyl]-N6-{[(2-Methyl-2-Propanyl)Oxy]Carbonyl}-L-Lysine |
| (S)-6-((tert-Butoxycarbonyl)amino)-2-(4-methylphenylsulfonamido)hexanoic acid |
| L-Lysine, N-[(1,1-dimethylethoxy)carbonyl]-N-[(4-methylphenyl)sulfonyl]- |
| N-[(4-Methylphenyl)sulfonyl]-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-lysine |
| Lysine derivative 2 |
| Tos-Lys(Boc)-OH |