Z-Lys(Boc)-OH structure
|
Common Name | Z-Lys(Boc)-OH | ||
|---|---|---|---|---|
| CAS Number | 2389-60-8 | Molecular Weight | 380.4 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 412.9±40.0 °C at 760 mmHg | |
| Molecular Formula | C19H28N2O6 | Melting Point | 50-52ºC (dec.) | |
| MSDS | N/A | Flash Point | 203.5±27.3 °C | |
| Name | (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 412.9±40.0 °C at 760 mmHg |
| Melting Point | 50-52ºC (dec.) |
| Molecular Formula | C19H28N2O6 |
| Molecular Weight | 380.4 |
| Flash Point | 203.5±27.3 °C |
| Exact Mass | 380.19473662 |
| PSA | 113.96000 |
| LogP | 0.74 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.485 |
| InChIKey | DYSBKEOCHROEGX-HNNXBMFYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Protease Inhibition Assay from Article 10.1016/j.bmcl.2004.12.068: "Lysine derivative...
Source: BindingDB
Target: N/A
External Id: BindingDB_1193_1
|
|
Name: Binding affinity against human immunodeficiency virus (HIV) protease
Source: ChEMBL
Target: Pol polyprotein
External Id: CHEMBL828879
|
| Z-Lys(Boc)-OH |
| MFCD00062271 |
| N-[(Benzyloxy)carbonyl]-N-{[(2-methyl-2-propanyl)oxy]carbonyl}lysine |
| N2-BENZYLOXYCARBONYL-N6-BOC-L-LYSINE |
| (S)-2-Amino-6-((tert-butoxycarbonyl)amino)hexanoic acid |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-lysine |
| (S)-2-(((Benzyloxy)carbonyl)amino)-6-((tert-butoxycarbonyl)amino)hexanoic acid |
| N2-benzyloxycarbonyl-N6-tert-butoxycarbonyl-L-lysine |
| Lysine derivative 1 |
| AmbotzZAA1184 |
| N-(Tert-Butoxycarbonyl)-L-Lysine |
| N-Cbz-N'-Boc-L-lysine |
| N2-Benzyloxycarbonyl-N6-tert-butyloxycarbonyl-L-lysine |
| Nε-Boc-Nα-Cbz-L-lysine |
| EINECS 219-223-1 |
| Nε-(tert-Butoxycarbonyl)-Nα-carbobenzoxy-L-lysine |
| Nepsilon-Boc-Nalpha-Cbz-L-Lysine |