2-Fluoro-1,3-dimethyl-4-nitrobenzene structure
|
Common Name | 2-Fluoro-1,3-dimethyl-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 1736-84-1 | Molecular Weight | 169.153 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 246.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H8FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 103.1±25.9 °C | |
| Name | 2-fluoro-1,3-dimethyl-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 246.8±35.0 °C at 760 mmHg |
| Molecular Formula | C8H8FNO2 |
| Molecular Weight | 169.153 |
| Flash Point | 103.1±25.9 °C |
| Exact Mass | 169.053909 |
| PSA | 45.82000 |
| LogP | 2.82 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | PWCKAUYAICHCSR-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])c(C)c1F |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene, 2-fluoro-1,3-dimethyl-4-nitro- |
| 2-Fluoro-1,3-dimethyl-4-nitrobenzene |
| 2,6-Dimethyl-3-nitrofluorobenzene |