Andrastin A structure
|
Common Name | Andrastin A | ||
|---|---|---|---|---|
| CAS Number | 174232-42-9 | Molecular Weight | 486.59700 | |
| Density | 1.19g/cm3 | Boiling Point | 560.3ºC at 760 mmHg | |
| Molecular Formula | C28H38O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.1ºC | |
Use of Andrastin AAndrastin A meroterpenoid compound, is a farnesyltransferase inhibitor. Andrastin A inhibits the efflux of anticancer compounds from multidrug-resistant cancer cells. Andrastin A can be isolated from Penicillium species[1][2]. |
| Name | Andrastin A |
|---|
| Description | Andrastin A meroterpenoid compound, is a farnesyltransferase inhibitor. Andrastin A inhibits the efflux of anticancer compounds from multidrug-resistant cancer cells. Andrastin A can be isolated from Penicillium species[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 560.3ºC at 760 mmHg |
| Molecular Formula | C28H38O7 |
| Molecular Weight | 486.59700 |
| Flash Point | 236.1ºC |
| Exact Mass | 486.26200 |
| PSA | 103.81000 |
| LogP | 3.86940 |
| Vapour Pressure | 1.39E-12mmHg at 25°C |
| Index of Refraction | 1.54 |
| InChIKey | GRBXNADBNJGZRK-GJEDHNSHSA-N |
| SMILES | COC(=O)C12C(=O)C(C)C(=O)C1(C)C(C)=CC1C3(C=O)CCC(OC(C)=O)C(C)(C)C3CCC12C |